C16H23N3S2 — CID 111518221
1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-(thiophen-3-ylmethyl)guanidine (PubChem CID 111518221) has the molecular formula C16H23N3S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111518221 |
| Molecular Formula | C16H23N3S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC(C)Cc1cccs1)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C16H23N3S2/c1-13(9-15-5-4-7-21-15)10-18-16(17-2)19(3)11-14-6-8-20-12-14/h4-8,12-13H,9-11H2,1-3H3,(H,17,18) |
| InChIKey | MNGAHRDJLRWXPL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|