C16H27N3S — CID 109496762
1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-pent-4-enylguanidine (PubChem CID 109496762) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-pent-4-enylguanidine.
| Compound Name | 1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496762 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1,2-dimethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C16H27N3S/c1-5-6-7-10-19(4)16(17-3)18-13-14(2)12-15-9-8-11-20-15/h5,8-9,11,14H,1,6-7,10,12-13H2,2-4H3,(H,17,18) |
| InChIKey | ZXYLVJOLHWLLEH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|