About 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one
8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one (PubChem CID 11150365) has the molecular formula C15H23ClO3
and a molecular weight of 286.80 g/mol. Its IUPAC name is 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one.
Molecular Properties
| Compound Name | 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one |
| PubChem CID | 11150365 |
| Molecular Formula | C15H23ClO3 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one |
| SMILES | CCCCCCCCC1=C(Cl)C(=O)CC12OCCO2 |
| InChI | InChI=1S/C15H23ClO3/c1-2-3-4-5-6-7-8-12-14(16)13(17)11-15(12)18-9-10-19-15/h2-11H2,1H3 |
| InChIKey | ZAXHFMVINGZZQX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
The IUPAC name of 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one (CID 11150365) is 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one.
What is the SMILES notation for 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
The canonical SMILES for 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one is CCCCCCCCC1=C(Cl)C(=O)CC12OCCO2.
What is the InChIKey of 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
The InChIKey is ZAXHFMVINGZZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClO3/c1-2-3-4-5-6-7-8-12-14(16)13(17)11-15(12)18-9-10-19-15/h2-11H2,1H3.
What are the key properties of 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one?
8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one has a molecular weight of 286.80 g/mol, XLogP of 3.95, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-9-octyl-1,4-dioxaspiro[4.4]non-8-en-7-one is sourced from PubChem (CID 11150365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).