About methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate
methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate (PubChem CID 15434635) has the molecular formula C15H21ClO5
and a molecular weight of 316.78 g/mol. Its IUPAC name is methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate.
Molecular Properties
| Compound Name | methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate |
| PubChem CID | 15434635 |
| Molecular Formula | C15H21ClO5 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate |
| SMILES | COC(=O)CCCCCCC1=C(Cl)C(=O)CC12OCCO2 |
| InChI | InChI=1S/C15H21ClO5/c1-19-13(18)7-5-3-2-4-6-11-14(16)12(17)10-15(11)20-8-9-21-15/h2-10H2,1H3 |
| InChIKey | CXMSOJFRAKILMC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate?
The IUPAC name of methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate (CID 15434635) is methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate.
What is the SMILES notation for methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate?
The canonical SMILES for methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate is COC(=O)CCCCCCC1=C(Cl)C(=O)CC12OCCO2.
What is the InChIKey of methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate?
The InChIKey is CXMSOJFRAKILMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO5/c1-19-13(18)7-5-3-2-4-6-11-14(16)12(17)10-15(11)20-8-9-21-15/h2-10H2,1H3.
What are the key properties of methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate?
methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate has a molecular weight of 316.78 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(8-chloro-7-oxo-1,4-dioxaspiro[4.4]non-8-en-9-yl)heptanoate is sourced from PubChem (CID 15434635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).