methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate

C14H20O5 — CID 12051009

IUPACmethyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate
SMILESCOC(=O)CCCCC(=O)C1=CCCC12OCCO2
InChIInChI=1S/C14H20O5/c1-17-13(16)7-3-2-6-12(15)11-5-4-8-14(11)18-9-10-19-14/h5H,2-4,6-10H2,1H3
InChIKeyRNFKJPSMFMHVJF-UHFFFAOYSA-N
MW268.31 g/mol
LogP1.75
Rot. Bonds6

About methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate

methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate (PubChem CID 12051009) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate.

Molecular Properties

Compound Namemethyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate
PubChem CID12051009
Molecular FormulaC14H20O5
Molecular Weight268.31 g/mol
Exact Mass268.13
IUPAC Namemethyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate
SMILESCOC(=O)CCCCC(=O)C1=CCCC12OCCO2
InChIInChI=1S/C14H20O5/c1-17-13(16)7-3-2-6-12(15)11-5-4-8-14(11)18-9-10-19-14/h5H,2-4,6-10H2,1H3
InChIKeyRNFKJPSMFMHVJF-UHFFFAOYSA-N
XLogP1.75
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate?
The IUPAC name of methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate (CID 12051009) is methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate.
What is the SMILES notation for methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate?
The canonical SMILES for methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate is COC(=O)CCCCC(=O)C1=CCCC12OCCO2.
What is the InChIKey of methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate?
The InChIKey is RNFKJPSMFMHVJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-17-13(16)7-3-2-6-12(15)11-5-4-8-14(11)18-9-10-19-14/h5H,2-4,6-10H2,1H3.
What are the key properties of methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate?
methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate has a molecular weight of 268.31 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(1,4-dioxaspiro[4.4]non-8-en-9-yl)-6-oxohexanoate is sourced from PubChem (CID 12051009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).