About methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate
methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate (PubChem CID 13296490) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate.
Analyze methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate?
The IUPAC name of methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate (CID 13296490) is methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate.
What is the SMILES notation for methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate?
The canonical SMILES for methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate is COC(=O)/C1=C/CCCCC2(C1)OCCO2.
What is the InChIKey of methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate?
The InChIKey is KIPKOACKKFZDKN-BJMVGYQFSA-N. The full InChI is InChI=1S/C12H18O4/c1-14-11(13)10-5-3-2-4-6-12(9-10)15-7-8-16-12/h5H,2-4,6-9H2,1H3/b10-5+.
What are the key properties of methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate?
methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate has a molecular weight of 226.27 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (7E)-1,4-dioxaspiro[4.7]dodec-7-ene-7-carboxylate is sourced from PubChem (CID 13296490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).