C11H16O4 — CID 11790518
ethyl 1,4-dioxaspiro[4.5]dec-6-ene-6-carboxylate (PubChem CID 11790518) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is ethyl 1,4-dioxaspiro[4.5]dec-6-ene-6-carboxylate.
| Compound Name | ethyl 1,4-dioxaspiro[4.5]dec-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 11790518 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | ethyl 1,4-dioxaspiro[4.5]dec-6-ene-6-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC12OCCO2 |
| InChI | InChI=1S/C11H16O4/c1-2-13-10(12)9-5-3-4-6-11(9)14-7-8-15-11/h5H,2-4,6-8H2,1H3 |
| InChIKey | MHSPXVXPFJSJDC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |