C10H12O5 — CID 11287305
methyl 8-oxo-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 11287305) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is methyl 8-oxo-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | methyl 8-oxo-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 11287305 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | methyl 8-oxo-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | COC(=O)C1=CC2(CCC1=O)OCCO2 |
| InChI | InChI=1S/C10H12O5/c1-13-9(12)7-6-10(3-2-8(7)11)14-4-5-15-10/h6H,2-5H2,1H3 |
| InChIKey | QKHWJOIAOHIAAL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|