C18H28N4O3 — CID 111503918
1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea (PubChem CID 111503918) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 111503918 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NCC(C)(O)c2cc(C)oc2C)n1 |
| InChI | InChI=1S/C18H28N4O3/c1-12-9-13(2)22(21-12)8-6-7-19-17(23)20-11-18(5,24)16-10-14(3)25-15(16)4/h9-10,24H,6-8,11H2,1-5H3,(H2,19,20,23) |
| InChIKey | RKHSIAWLFTZRLI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|