C15H24N2O2S — CID 111504805
1-[(5-ethylthiophen-2-yl)methyl]-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111504805) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111504805 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | CCc1ccc(CNC(=O)NCC2CCCC(O)C2)s1 |
| InChI | InChI=1S/C15H24N2O2S/c1-2-13-6-7-14(20-13)10-17-15(19)16-9-11-4-3-5-12(18)8-11/h6-7,11-12,18H,2-5,8-10H2,1H3,(H2,16,17,19) |
| InChIKey | WDTMNIOGYVTGNF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |