C17H23FN2O3 — CID 111505327
1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(3-hydroxy-4-methylpentyl)urea (PubChem CID 111505327) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(3-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(3-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 111505327 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(3-hydroxy-4-methylpentyl)urea |
| SMILES | Cc1c(CNC(=O)NCCC(O)C(C)C)oc2ccc(F)cc12 |
| InChI | InChI=1S/C17H23FN2O3/c1-10(2)14(21)6-7-19-17(22)20-9-16-11(3)13-8-12(18)4-5-15(13)23-16/h4-5,8,10,14,21H,6-7,9H2,1-3H3,(H2,19,20,22) |
| InChIKey | BQFCIQSFPNPWST-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |