C13H16FNO2 — CID 113410126
3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]propan-1-ol (PubChem CID 113410126) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 113410126 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]propan-1-ol |
| SMILES | Cc1c(CNCCCO)oc2ccc(F)cc12 |
| InChI | InChI=1S/C13H16FNO2/c1-9-11-7-10(14)3-4-12(11)17-13(9)8-15-5-2-6-16/h3-4,7,15-16H,2,5-6,8H2,1H3 |
| InChIKey | COBXDFNOPIKIHN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|