C18H20FN3OS — CID 111350830
1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111350830) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111350830 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)NCc1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C18H20FN3OS/c1-12-15-10-13(19)5-6-16(15)23-17(12)11-22-18(20-2)21-8-7-14-4-3-9-24-14/h3-6,9-10H,7-8,11H2,1-2H3,(H2,20,21,22) |
| InChIKey | UKDDQDCPUVXLKI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|