C15H18F2IN3S — CID 111258740
1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258740) has the molecular formula C15H18F2IN3S and a molecular weight of 437.30 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258740 |
| Molecular Formula | C15H18F2IN3S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc(F)c1)NCc1cccs1.I |
| InChI | InChI=1S/C15H17F2N3S.HI/c1-18-15(20-10-14-3-2-6-21-14)19-5-4-11-7-12(16)9-13(17)8-11;/h2-3,6-9H,4-5,10H2,1H3,(H2,18,19,20);1H |
| InChIKey | SIIQALYFQJUJHU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|