C15H28N4O2 — CID 111507020
1-(2-hydroxy-2-propylpentyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 111507020) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(2-hydroxy-2-propylpentyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(2-hydroxy-2-propylpentyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 111507020 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-(2-hydroxy-2-propylpentyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | CCCC(O)(CCC)CNC(=O)NC(C)c1cnn(C)c1 |
| InChI | InChI=1S/C15H28N4O2/c1-5-7-15(21,8-6-2)11-16-14(20)18-12(3)13-9-17-19(4)10-13/h9-10,12,21H,5-8,11H2,1-4H3,(H2,16,18,20) |
| InChIKey | AZDJBIRDSJETQB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |