C16H33N3O2 — CID 111508128
1-(2-hydroxy-2,3-dimethylpentyl)-3-(1-propylpiperidin-4-yl)urea (PubChem CID 111508128) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dimethylpentyl)-3-(1-propylpiperidin-4-yl)urea.
| Compound Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-(1-propylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 111508128 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-(1-propylpiperidin-4-yl)urea |
| SMILES | CCCN1CCC(NC(=O)NCC(C)(O)C(C)CC)CC1 |
| InChI | InChI=1S/C16H33N3O2/c1-5-9-19-10-7-14(8-11-19)18-15(20)17-12-16(4,21)13(3)6-2/h13-14,21H,5-12H2,1-4H3,(H2,17,18,20) |
| InChIKey | SYTNFSKNCZZDPB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |