C18H36IN5S — CID 111509826
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111509826) has the molecular formula C18H36IN5S and a molecular weight of 481.49 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111509826 |
| Molecular Formula | C18H36IN5S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C18H35N5S.HI/c1-6-16-13-20-17(24-16)14-21-18(19-7-2)22-15(5)11-10-12-23(8-3)9-4;/h13,15H,6-12,14H2,1-5H3,(H2,19,21,22);1H |
| InChIKey | GWZKSJQNCJKMPX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|