C16H22F3NO3 — CID 111510943
1-[1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]ethanol (PubChem CID 111510943) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-[1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 111510943 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[1-[2-[4-(trifluoromethoxy)phenoxy]ethyl]piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(CCOc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H22F3NO3/c1-12(21)13-6-8-20(9-7-13)10-11-22-14-2-4-15(5-3-14)23-16(17,18)19/h2-5,12-13,21H,6-11H2,1H3 |
| InChIKey | GKFQKCLFTSZWQG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |