About 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene
1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene (PubChem CID 145415282) has the molecular formula C20H24F3NO4
and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene.
Molecular Properties
| Compound Name | 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene |
| PubChem CID | 145415282 |
| Molecular Formula | C20H24F3NO4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene |
| SMILES | FC(F)(F)Oc1ccccc1.OCc1ccc(OCCN2CCC(O)C2)cc1 |
| InChI | InChI=1S/C13H19NO3.C7H5F3O/c15-10-11-1-3-13(4-2-11)17-8-7-14-6-5-12(16)9-14;8-7(9,10)11-6-4-2-1-3-5-6/h1-4,12,15-16H,5-10H2;1-5H |
| InChIKey | OELLXJZICSOMTC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene?
The IUPAC name of 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene (CID 145415282) is 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene.
What is the SMILES notation for 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene?
The canonical SMILES for 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene is FC(F)(F)Oc1ccccc1.OCc1ccc(OCCN2CCC(O)C2)cc1.
What is the InChIKey of 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene?
The InChIKey is OELLXJZICSOMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3.C7H5F3O/c15-10-11-1-3-13(4-2-11)17-8-7-14-6-5-12(16)9-14;8-7(9,10)11-6-4-2-1-3-5-6/h1-4,12,15-16H,5-10H2;1-5H.
What are the key properties of 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene?
1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene has a molecular weight of 399.41 g/mol, XLogP of 3.21, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-(hydroxymethyl)phenoxy]ethyl]pyrrolidin-3-ol;trifluoromethoxybenzene is sourced from PubChem (CID 145415282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).