C20H23F3N2O2 — CID 145415484
[4-[2-[3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]ethoxy]phenyl]methanol (PubChem CID 145415484) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is [4-[2-[3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]ethoxy]phenyl]methanol.
| Compound Name | [4-[2-[3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 145415484 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [4-[2-[3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]ethoxy]phenyl]methanol |
| SMILES | OCc1ccc(OCCN2CCC(Nc3ccccc3C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C20H23F3N2O2/c21-20(22,23)18-3-1-2-4-19(18)24-16-9-10-25(13-16)11-12-27-17-7-5-15(14-26)6-8-17/h1-8,16,24,26H,9-14H2 |
| InChIKey | DUAHDAKHSGMPPK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |