C16H22F3N3O2 — CID 51093545
1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 51093545) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 51093545 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | COCCN1CCC(NC(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-24-11-10-22-8-6-12(7-9-22)20-15(23)21-14-5-3-2-4-13(14)16(17,18)19/h2-5,12H,6-11H2,1H3,(H2,20,21,23) |
| InChIKey | OTELDYBTIPYYLR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |