C22H33N5O2 — CID 119048970
1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[1-(2-methylphenyl)-5-propan-2-ylpyrazol-4-yl]urea (PubChem CID 119048970) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[1-(2-methylphenyl)-5-propan-2-ylpyrazol-4-yl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[1-(2-methylphenyl)-5-propan-2-ylpyrazol-4-yl]urea |
|---|---|
| PubChem CID | 119048970 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-[1-(2-methoxyethyl)piperidin-4-yl]-3-[1-(2-methylphenyl)-5-propan-2-ylpyrazol-4-yl]urea |
| SMILES | COCCN1CCC(NC(=O)Nc2cnn(-c3ccccc3C)c2C(C)C)CC1 |
| InChI | InChI=1S/C22H33N5O2/c1-16(2)21-19(15-23-27(21)20-8-6-5-7-17(20)3)25-22(28)24-18-9-11-26(12-10-18)13-14-29-4/h5-8,15-16,18H,9-14H2,1-4H3,(H2,24,25,28) |
| InChIKey | JLOYTBWRQYRHSC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |