C17H27N3O — CID 6470893
1-(2,3-dimethylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea (PubChem CID 6470893) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 6470893 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea |
| SMILES | Cc1cccc(NC(=O)NC2CCN(C(C)C)CC2)c1C |
| InChI | InChI=1S/C17H27N3O/c1-12(2)20-10-8-15(9-11-20)18-17(21)19-16-7-5-6-13(3)14(16)4/h5-7,12,15H,8-11H2,1-4H3,(H2,18,19,21) |
| InChIKey | KHPIJEBTWKYXAH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |