C20H31ClN4O — CID 112824885
1-(5-chloro-2-piperidin-1-ylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea (PubChem CID 112824885) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is 1-(5-chloro-2-piperidin-1-ylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(5-chloro-2-piperidin-1-ylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 112824885 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-(5-chloro-2-piperidin-1-ylphenyl)-3-(1-propan-2-ylpiperidin-4-yl)urea |
| SMILES | CC(C)N1CCC(NC(=O)Nc2cc(Cl)ccc2N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H31ClN4O/c1-15(2)24-12-8-17(9-13-24)22-20(26)23-18-14-16(21)6-7-19(18)25-10-4-3-5-11-25/h6-7,14-15,17H,3-5,8-13H2,1-2H3,(H2,22,23,26) |
| InChIKey | UBTIXQPGJMFVQQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |