C16H22ClN3O3 — CID 95291147
1-(5-chloro-2-morpholin-4-ylphenyl)-3-[(3S)-oxan-3-yl]urea (PubChem CID 95291147) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 1-(5-chloro-2-morpholin-4-ylphenyl)-3-[(3S)-oxan-3-yl]urea.
| Compound Name | 1-(5-chloro-2-morpholin-4-ylphenyl)-3-[(3S)-oxan-3-yl]urea |
|---|---|
| PubChem CID | 95291147 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-(5-chloro-2-morpholin-4-ylphenyl)-3-[(3S)-oxan-3-yl]urea |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCOCC1)N[C@H]1CCCOC1 |
| InChI | InChI=1S/C16H22ClN3O3/c17-12-3-4-15(20-5-8-22-9-6-20)14(10-12)19-16(21)18-13-2-1-7-23-11-13/h3-4,10,13H,1-2,5-9,11H2,(H2,18,19,21)/t13-/m0/s1 |
| InChIKey | UFJIMFNVVRHJON-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |