C15H30N4O2S — CID 111511906
2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111511906) has the molecular formula C15H30N4O2S and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111511906 |
| Molecular Formula | C15H30N4O2S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCOCC1)NCC1(SC)CCOCC1 |
| InChI | InChI=1S/C15H30N4O2S/c1-16-14(17-5-6-19-7-11-21-12-8-19)18-13-15(22-2)3-9-20-10-4-15/h3-13H2,1-2H3,(H2,16,17,18) |
| InChIKey | CNXPOOUCOGQCRU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|