C16H34IN3O2S — CID 111513175
1-(3-butoxypropyl)-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111513175) has the molecular formula C16H34IN3O2S and a molecular weight of 459.44 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111513175 |
| Molecular Formula | C16H34IN3O2S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-(3-butoxypropyl)-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\C)NCC1(SC)CCOCC1.I |
| InChI | InChI=1S/C16H33N3O2S.HI/c1-4-5-10-20-11-6-9-18-15(17-2)19-14-16(22-3)7-12-21-13-8-16;/h4-14H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | MERAYYJBNYXBDE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|