C15H24N4S — CID 111512418
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111512418) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111512418 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCC1=CCCCC1)NCc1ncc(C)s1 |
| InChI | InChI=1S/C15H24N4S/c1-12-10-18-14(20-12)11-19-15(16-2)17-9-8-13-6-4-3-5-7-13/h6,10H,3-5,7-9,11H2,1-2H3,(H2,16,17,19) |
| InChIKey | YYDJDSTVHIXKTG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|