C20H30O3 — CID 11151305
(2S,3R,5Z)-3-hydroxy-2-[(1E,3Z,5Z)-undeca-1,3,5-trienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 11151305) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2S,3R,5Z)-3-hydroxy-2-[(1E,3Z,5Z)-undeca-1,3,5-trienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2S,3R,5Z)-3-hydroxy-2-[(1E,3Z,5Z)-undeca-1,3,5-trienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 11151305 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S,3R,5Z)-3-hydroxy-2-[(1E,3Z,5Z)-undeca-1,3,5-trienyl]-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCC/C=C\C=C/C=C/[C@@H]1OC(=O)CCC/C=C\C[C@H]1O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-13-16-19-18(21)15-12-10-11-14-17-20(22)23-19/h6-10,12-13,16,18-19,21H,2-5,11,14-15,17H2,1H3/b7-6-,9-8-,12-10-,16-13+/t18-,19+/m1/s1 |
| InChIKey | RZTWPOHZVRQFRZ-NGKPOOASSA-N |
| XLogP | 4.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|