C16H22FIN4S — CID 111515023
3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111515023) has the molecular formula C16H22FIN4S and a molecular weight of 448.35 g/mol. Its IUPAC name is 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515023 |
| Molecular Formula | C16H22FIN4S |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H21FN4S.HI/c1-4-18-16(20-10-15-19-9-12(2)22-15)21(3)11-13-5-7-14(17)8-6-13;/h5-9H,4,10-11H2,1-3H3,(H,18,20);1H |
| InChIKey | FAHCJJWMUZFLFJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|