C17H12ClN3S — CID 11151524
3-[(6-chloro-3-pyridinyl)methyl]-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 11151524) has the molecular formula C17H12ClN3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 11151524 |
| Molecular Formula | C17H12ClN3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1ccc(Cc2c[nH]c3nccc(-c4ccsc4)c23)cn1 |
| InChI | InChI=1S/C17H12ClN3S/c18-15-2-1-11(8-20-15)7-13-9-21-17-16(13)14(3-5-19-17)12-4-6-22-10-12/h1-6,8-10H,7H2,(H,19,21) |
| InChIKey | PKBLYINFSSVLPT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|