C23H21ClN4 — CID 58259004
3-[[6-[2-(6-chloro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-cyclopropyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58259004) has the molecular formula C23H21ClN4 and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-[[6-[2-(6-chloro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-cyclopropyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[6-[2-(6-chloro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-cyclopropyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58259004 |
| Molecular Formula | C23H21ClN4 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[[6-[2-(6-chloro-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-cyclopropyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1ccc(CCc2ccc(Cc3c[nH]c4ncc(C5CC5)cc34)cn2)cn1 |
| InChI | InChI=1S/C23H21ClN4/c24-22-8-3-15(11-26-22)1-6-20-7-2-16(12-25-20)9-19-14-28-23-21(19)10-18(13-27-23)17-4-5-17/h2-3,7-8,10-14,17H,1,4-6,9H2,(H,27,28) |
| InChIKey | SBXGZKQEWLRLJG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|