C24H24ClN5O — CID 58442252
4-[4-[2-[5-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]pyrimidin-2-yl]ethyl]phenyl]morpholine (PubChem CID 58442252) has the molecular formula C24H24ClN5O and a molecular weight of 433.94 g/mol. Its IUPAC name is 4-[4-[2-[5-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]pyrimidin-2-yl]ethyl]phenyl]morpholine.
| Compound Name | 4-[4-[2-[5-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]pyrimidin-2-yl]ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 58442252 |
| Molecular Formula | C24H24ClN5O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-[4-[2-[5-[(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]pyrimidin-2-yl]ethyl]phenyl]morpholine |
| SMILES | Clc1cnc2[nH]cc(Cc3cnc(CCc4ccc(N5CCOCC5)cc4)nc3)c2c1 |
| InChI | InChI=1S/C24H24ClN5O/c25-20-12-22-19(15-28-24(22)29-16-20)11-18-13-26-23(27-14-18)6-3-17-1-4-21(5-2-17)30-7-9-31-10-8-30/h1-2,4-5,12-16H,3,6-11H2,(H,28,29) |
| InChIKey | CFEAZEZFOCUBBM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|