C21H18ClFN4O — CID 58442210
5-chloro-3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58442210) has the molecular formula C21H18ClFN4O and a molecular weight of 396.85 g/mol. Its IUPAC name is 5-chloro-3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-chloro-3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58442210 |
| Molecular Formula | C21H18ClFN4O |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-chloro-3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(CCc2ccc(Cc3c[nH]c4ncc(Cl)cc34)c(F)n2)cn1 |
| InChI | InChI=1S/C21H18ClFN4O/c1-28-19-7-3-13(10-24-19)2-5-17-6-4-14(20(23)27-17)8-15-11-25-21-18(15)9-16(22)12-26-21/h3-4,6-7,9-12H,2,5,8H2,1H3,(H,25,26) |
| InChIKey | JPVWLPUVQLYTIJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|