C23H21F2N3O — CID 58259168
3-[[2-fluoro-6-[2-(3-fluoro-5-methoxyphenyl)ethyl]-3-pyridinyl]methyl]-5-methyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58259168) has the molecular formula C23H21F2N3O and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[[2-fluoro-6-[2-(3-fluoro-5-methoxyphenyl)ethyl]-3-pyridinyl]methyl]-5-methyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[2-fluoro-6-[2-(3-fluoro-5-methoxyphenyl)ethyl]-3-pyridinyl]methyl]-5-methyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58259168 |
| Molecular Formula | C23H21F2N3O |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[[2-fluoro-6-[2-(3-fluoro-5-methoxyphenyl)ethyl]-3-pyridinyl]methyl]-5-methyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc(F)cc(CCc2ccc(Cc3c[nH]c4ncc(C)cc34)c(F)n2)c1 |
| InChI | InChI=1S/C23H21F2N3O/c1-14-7-21-17(13-27-23(21)26-12-14)10-16-4-6-19(28-22(16)25)5-3-15-8-18(24)11-20(9-15)29-2/h4,6-9,11-13H,3,5,10H2,1-2H3,(H,26,27) |
| InChIKey | SCJORANVWKNDIB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|