C21H32IN3O3S — CID 111519088
1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111519088) has the molecular formula C21H32IN3O3S and a molecular weight of 533.48 g/mol. Its IUPAC name is 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519088 |
| Molecular Formula | C21H32IN3O3S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCOc1cccc2cc(C(C)N/C(=N/C)NCC3(SC)CCOCC3)oc12.I |
| InChI | InChI=1S/C21H31N3O3S.HI/c1-5-26-17-8-6-7-16-13-18(27-19(16)17)15(2)24-20(22-3)23-14-21(28-4)9-11-25-12-10-21;/h6-8,13,15H,5,9-12,14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | DZPQLSICCKKNIP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|