C17H26Cl2IN3OS — CID 111515744
1-[1-(3,4-dichlorophenyl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111515744) has the molecular formula C17H26Cl2IN3OS and a molecular weight of 518.29 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515744 |
| Molecular Formula | C17H26Cl2IN3OS |
| Molecular Weight | 518.29 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-2-methyl-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)NC(C)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C17H25Cl2N3OS.HI/c1-12(13-4-5-14(18)15(19)10-13)22-16(20-2)21-11-17(24-3)6-8-23-9-7-17;/h4-5,10,12H,6-9,11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | WNPGRNSREJWDLK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|