C19H23N3O2 — CID 111520282
N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 111520282) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111520282 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1CN1CCC(O)CC1)c1cccnc1 |
| InChI | InChI=1S/C19H23N3O2/c23-18-7-10-22(11-8-18)14-17-5-2-1-4-15(17)13-21-19(24)16-6-3-9-20-12-16/h1-6,9,12,18,23H,7-8,10-11,13-14H2,(H,21,24) |
| InChIKey | XBJYWAMANXNWHL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |