C26H29N3O3 — CID 56552164
N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-3-ylmethoxy)benzamide (PubChem CID 56552164) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 56552164 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-3-(pyridin-3-ylmethoxy)benzamide |
| SMILES | O=C(NCc1ccc(CN2CCC(O)CC2)cc1)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C26H29N3O3/c30-24-10-13-29(14-11-24)18-21-8-6-20(7-9-21)17-28-26(31)23-4-1-5-25(15-23)32-19-22-3-2-12-27-16-22/h1-9,12,15-16,24,30H,10-11,13-14,17-19H2,(H,28,31) |
| InChIKey | KDOOAFAUAKKWBE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |