C20H29NO2Si — CID 11152096
(4R)-4-phenyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one (PubChem CID 11152096) has the molecular formula C20H29NO2Si and a molecular weight of 343.54 g/mol. Its IUPAC name is (4R)-4-phenyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11152096 |
| Molecular Formula | C20H29NO2Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (4R)-4-phenyl-3-[2-tri(propan-2-yl)silylethynyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[Si](C#CN1C(=O)OC[C@H]1c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H29NO2Si/c1-15(2)24(16(3)4,17(5)6)13-12-21-19(14-23-20(21)22)18-10-8-7-9-11-18/h7-11,15-17,19H,14H2,1-6H3/t19-/m0/s1 |
| InChIKey | VDZCKNSJAMCWGC-IBGZPJMESA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|