C16H25FN2O3 — CID 111521074
1-(2,2-diethyl-4-hydroxybutyl)-3-(4-fluoro-2-methoxyphenyl)urea (PubChem CID 111521074) has the molecular formula C16H25FN2O3 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-(4-fluoro-2-methoxyphenyl)urea.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-(4-fluoro-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 111521074 |
| Molecular Formula | C16H25FN2O3 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-(4-fluoro-2-methoxyphenyl)urea |
| SMILES | CCC(CC)(CCO)CNC(=O)Nc1ccc(F)cc1OC |
| InChI | InChI=1S/C16H25FN2O3/c1-4-16(5-2,8-9-20)11-18-15(21)19-13-7-6-12(17)10-14(13)22-3/h6-7,10,20H,4-5,8-9,11H2,1-3H3,(H2,18,19,21) |
| InChIKey | RJTQUAUTGGYKFK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |