C19H29N5S — CID 111522182
1-(2-anilino-3-methylbutyl)-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111522182) has the molecular formula C19H29N5S and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-(2-anilino-3-methylbutyl)-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-(2-anilino-3-methylbutyl)-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111522182 |
| Molecular Formula | C19H29N5S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-(2-anilino-3-methylbutyl)-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCC(Nc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H29N5S/c1-5-20-19(23-13-18-21-11-15(4)25-18)22-12-17(14(2)3)24-16-9-7-6-8-10-16/h6-11,14,17,24H,5,12-13H2,1-4H3,(H2,20,22,23) |
| InChIKey | USUKZDDSPVXZIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|