C20H26N6S — CID 111522677
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111522677) has the molecular formula C20H26N6S and a molecular weight of 382.54 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111522677 |
| Molecular Formula | C20H26N6S |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCc1c(C)nn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C20H26N6S/c1-14-10-22-19(27-14)12-24-20(21-4)23-11-18-15(2)25-26(16(18)3)13-17-8-6-5-7-9-17/h5-10H,11-13H2,1-4H3,(H2,21,23,24) |
| InChIKey | JJBYJCMZAQZIRX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|