C21H28IN5S — CID 111893510
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111893510) has the molecular formula C21H28IN5S and a molecular weight of 509.46 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893510 |
| Molecular Formula | C21H28IN5S |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1sccc1C)NCc1c(C)nn(Cc2ccccc2)c1C.I |
| InChI | InChI=1S/C21H27N5S.HI/c1-15-10-11-27-20(15)13-24-21(22-4)23-12-19-16(2)25-26(17(19)3)14-18-8-6-5-7-9-18;/h5-11H,12-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | URXMPMDNKZAYGL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|