C20H28IN5O2S — CID 111524823
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111524823) has the molecular formula C20H28IN5O2S and a molecular weight of 529.45 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111524823 |
| Molecular Formula | C20H28IN5O2S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-(3-morpholin-4-yl-3-oxo-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C)s1)NCC(C(=O)N1CCOCC1)c1ccccc1.I |
| InChI | InChI=1S/C20H27N5O2S.HI/c1-15-12-22-18(28-15)14-24-20(21-2)23-13-17(16-6-4-3-5-7-16)19(26)25-8-10-27-11-9-25;/h3-7,12,17H,8-11,13-14H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | VUMMTOGIXPXTJB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|