C23H38N4O — CID 111526569
N'-methyl-N-[2-(2-methylpiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111526569) has the molecular formula C23H38N4O and a molecular weight of 386.58 g/mol. Its IUPAC name is N'-methyl-N-[2-(2-methylpiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(2-methylpiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111526569 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | N'-methyl-N-[2-(2-methylpiperidin-1-yl)propyl]-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(C)N1CCCCC1C)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C23H38N4O/c1-19-9-7-8-13-27(19)20(2)15-25-23(24-3)26-14-12-22(16-26)18-28-17-21-10-5-4-6-11-21/h4-6,10-11,19-20,22H,7-9,12-18H2,1-3H3,(H,24,25) |
| InChIKey | HYGRMWALCFEHGE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|