C19H20O6S — CID 11153086
(1S,4S,9S,11S,12S)-11,12-dihydroxy-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]tridec-3(7)-ene-6,8-dione (PubChem CID 11153086) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is (1S,4S,9S,11S,12S)-11,12-dihydroxy-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]tridec-3(7)-ene-6,8-dione.
| Compound Name | (1S,4S,9S,11S,12S)-11,12-dihydroxy-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]tridec-3(7)-ene-6,8-dione |
|---|---|
| PubChem CID | 11153086 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (1S,4S,9S,11S,12S)-11,12-dihydroxy-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]tridec-3(7)-ene-6,8-dione |
| SMILES | C[C@]12C[C@H](OC3=C(C(=O)O[C@@]3(C)Sc3ccccc3)C1=O)[C@@H](O)[C@@H](O)C2 |
| InChI | InChI=1S/C19H20O6S/c1-18-8-11(20)14(21)12(9-18)24-16-13(15(18)22)17(23)25-19(16,2)26-10-6-4-3-5-7-10/h3-7,11-12,14,20-21H,8-9H2,1-2H3/t11-,12-,14-,18-,19-/m0/s1 |
| InChIKey | MVZXONRNMFMPFC-UPEVVCSUSA-N |
| XLogP | 1.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|