C19H18O4S — CID 134973794
(1S,4S,9S)-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]trideca-3(7),11-diene-6,8-dione (PubChem CID 134973794) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is (1S,4S,9S)-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]trideca-3(7),11-diene-6,8-dione.
| Compound Name | (1S,4S,9S)-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]trideca-3(7),11-diene-6,8-dione |
|---|---|
| PubChem CID | 134973794 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (1S,4S,9S)-4,9-dimethyl-4-phenylsulfanyl-2,5-dioxatricyclo[7.3.1.03,7]trideca-3(7),11-diene-6,8-dione |
| SMILES | C[C@]12CC=C[C@H](C1)OC1=C(C(=O)O[C@@]1(C)Sc1ccccc1)C2=O |
| InChI | InChI=1S/C19H18O4S/c1-18-10-6-7-12(11-18)22-16-14(15(18)20)17(21)23-19(16,2)24-13-8-4-3-5-9-13/h3-9,12H,10-11H2,1-2H3/t12-,18+,19+/m1/s1 |
| InChIKey | IWZPMCYVARKGLS-HQOQDVMHSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|