C22H27FIN5OS — CID 111531332
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111531332) has the molecular formula C22H27FIN5OS and a molecular weight of 555.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531332 |
| Molecular Formula | C22H27FIN5OS |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Oc2cccnc2)c(F)c1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C22H26FN5OS.HI/c1-3-18-15-27-21(30-18)9-11-26-22(25-4-2)28-13-16-7-8-20(19(23)12-16)29-17-6-5-10-24-14-17;/h5-8,10,12,14-15H,3-4,9,11,13H2,1-2H3,(H2,25,26,28);1H |
| InChIKey | VEDJSFSBDHAKIQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|