C23H23FN4O3 — CID 111846337
1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine (PubChem CID 111846337) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111846337 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Oc2cccnc2)c(F)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H23FN4O3/c1-2-26-23(28-13-17-6-8-21-22(11-17)30-15-29-21)27-12-16-5-7-20(19(24)10-16)31-18-4-3-9-25-14-18/h3-11,14H,2,12-13,15H2,1H3,(H2,26,27,28) |
| InChIKey | LROVZSILMORPDQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|